1566-42-3 (4-Methoxyphenyl)-urea
상품명칭 |
(4-Methoxyphenyl)-urea |
영문 이름 |
(4-Methoxyphenyl)-urea; 4-Methoxyphenylurea; 1-(4-methoxyphenyl)urea |
분자식 |
C8H10N2O2 |
분자량 |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-12-7-4-2-6(3-5-7)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
cas번호 |
1566-42-3 |
EC번호 |
216-368-2 |
분자 구조 |
|
밀도 |
1.243g/cm3 |
비등점 |
284.7°C at 760 mmHg |
굴절 지수 |
1.606 |
인화점 |
126°C |
증기압 |
0.00293mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|