1577-22-6 5-Hexenoic acid
상품명칭 |
5-Hexenoic acid |
영문 이름 |
5-Hexenoic acid;hex-5-enoic acid |
분자식 |
C6H10O2 |
분자량 |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H,7,8) |
cas번호 |
1577-22-6 |
분자 구조 |
|
밀도 |
0.973g/cm3 |
비등점 |
202.6°C at 760 mmHg |
굴절 지수 |
1.443 |
인화점 |
100.1°C |
증기압 |
0.12mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|