ChemNet > CAS > 15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
| 상품명칭 |
octanoic acid, compound with dicyclohexylamine (1:1) |
| 영문 이름 |
octanoic acid, compound with dicyclohexylamine (1:1); Octanoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine caprylate; N-cyclohexylcyclohexanaminium octanoate |
| 분자식 |
C20H39NO2 |
| 분자량 |
325.5292 |
| InChI |
InChI=1/C12H23N.C8H16O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8(9)10/h11-13H,1-10H2;2-7H2,1H3,(H,9,10) |
| cas번호 |
15816-71-4 |
| EC번호 |
239-914-1 |
| 분자 구조 |
|
| 비등점 |
466.8°C at 760 mmHg |
| 인화점 |
236.1°C |
| 증기압 |
5.25E-10mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
