ChemNet > CAS > 158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
158296-69-6 4-Amino-3-chloro-5-methylbenzonitrile
| 상품명칭 |
4-Amino-3-chloro-5-methylbenzonitrile |
| 영문 이름 |
4-Amino-3-chloro-5-methylbenzonitrile; 2-Chloro-4-cyano-6-methylaniline |
| 분자식 |
C8H7ClN2 |
| 분자량 |
166.6076 |
| InChI |
InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
| cas번호 |
158296-69-6 |
| 분자 구조 |
|
| 밀도 |
1.27g/cm3 |
| 비등점 |
302°C at 760 mmHg |
| 굴절 지수 |
1.594 |
| 인화점 |
136.5°C |
| 증기압 |
0.00102mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
