ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
| 상품명칭 |
Cyclohexanone 2,4-dinitrophenylhydrazone |
| 영문 이름 |
Cyclohexanone 2,4-dinitrophenylhydrazone;Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
| 분자식 |
C12H14N4O4 |
| 분자량 |
278.264 |
| InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
| cas번호 |
1589-62-4 |
| EC번호 |
216-458-1 |
| 분자 구조 |
|
| 밀도 |
1.47g/cm3 |
| 녹는 점 |
159-161℃ |
| 비등점 |
434.6°C at 760 mmHg |
| 굴절 지수 |
1.665 |
| 인화점 |
216.7°C |
| 증기압 |
9.33E-08mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
