ChemNet > CAS > 1590-08-5 2-Methyl-1-tetralone
1590-08-5 2-Methyl-1-tetralone
| 상품명칭 |
2-Methyl-1-tetralone |
| 영문 이름 |
2-Methyl-1-tetralone; 1,2,3,4-tetrahydro-2-methylnaphthalen-1-one; 2-methyl-3,4-dihydronaphthalen-1(2H)-one; (2R)-2-methyl-3,4-dihydronaphthalen-1(2H)-one; (2S)-2-methyl-3,4-dihydronaphthalen-1(2H)-one |
| 분자식 |
C11H12O |
| 분자량 |
160.2124 |
| InChI |
InChI=1/C11H12O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-5,8H,6-7H2,1H3/t8-/m0/s1 |
| cas번호 |
1590-08-5 |
| EC번호 |
216-461-8 |
| 분자 구조 |
|
| 밀도 |
1.048g/cm3 |
| 비등점 |
262.3°C at 760 mmHg |
| 굴절 지수 |
1.539 |
| 인화점 |
107°C |
| 증기압 |
0.011mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
