ChemNet > CAS > 1594-56-5 2,4-Dinitrophenyl thiocyanate
1594-56-5 2,4-Dinitrophenyl thiocyanate
| 상품명칭 |
2,4-Dinitrophenyl thiocyanate |
| 영문 이름 |
2,4-Dinitrophenyl thiocyanate; 2,4-Dinitrothiocyanatobenzene |
| 분자식 |
C7H3N3O4S |
| 분자량 |
225.1814 |
| InChI |
InChI=1/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H |
| cas번호 |
1594-56-5 |
| EC번호 |
216-477-5 |
| 분자 구조 |
|
| 밀도 |
1.62g/cm3 |
| 녹는 점 |
138-140℃ |
| 비등점 |
368.4°C at 760 mmHg |
| 굴절 지수 |
1.666 |
| 인화점 |
176.6°C |
| 증기압 |
1.28E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R32:Contact with acids liberates very toxic gas.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
