ChemNet > CAS > 159954-28-6 연어 글루코 시드
159954-28-6 연어 글루코 시드
| 상품명칭 |
연어 글루코 시드 |
| 별명 |
; 6-클로로-3-인독실-베타-D-글루코피라노사이드; 연어-베타-D-글루코사이드; 6-클로로-1H-인돌-3-일-알파-D-글루코피라노사이드 |
| 영문 이름 |
Salmon Glucoside; 6-Chloro-3-indoxyl-beta-D-glucopyranoside; Salmon-beta-D-glucoside; 6-chloro-1H-indol-3-yl alpha-D-glucopyranoside |
| 분자식 |
C14H16ClNO6 |
| 분자량 |
329.7329 |
| InChI |
InChI=1/C14H16ClNO6/c15-6-1-2-7-8(3-6)16-4-9(7)21-14-13(20)12(19)11(18)10(5-17)22-14/h1-4,10-14,16-20H,5H2/t10-,11-,12+,13-,14+/m1/s1 |
| cas번호 |
159954-28-6 |
| 분자 구조 |
|
| 밀도 |
1.641g/cm3 |
| 비등점 |
630.2°C at 760 mmHg |
| 굴절 지수 |
1.717 |
| 인화점 |
334.9°C |
| 증기압 |
9.45E-17mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
