16000-39-8 2-메톡시-1-나프토니트릴
| 상품명칭 |
2-메톡시-1-나프토니트릴 |
| 별명 |
; 1-시아노-2-메톡시나프탈렌; 2-메톡시나프탈렌-1-카보니트릴 |
| 영문 이름 |
2-Methoxy-1-naphthonitrile; 1-Cyano-2-methoxynaphtalene; 2-methoxynaphthalene-1-carbonitrile |
| 분자식 |
C12H9NO |
| 분자량 |
183.206 |
| InChI |
InChI=1/C12H9NO/c1-14-12-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-7H,1H3 |
| cas번호 |
16000-39-8 |
| EC번호 |
240-133-3 |
| 분자 구조 |
|
| 밀도 |
1.16g/cm3 |
| 녹는 점 |
94-96℃ |
| 비등점 |
362.8°C at 760 mmHg |
| 굴절 지수 |
1.622 |
| 인화점 |
153°C |
| 증기압 |
1.89E-05mmHg at 25°C |
| 위험성 표시 |
Xn:Harmful;
|
| 리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|