상품명칭 |
L-1,4-Dithiothreitol |
영문 이름 |
L-1,4-Dithiothreitol; (+/-)-1,4-Dimercapto-2,3-butanediol; (2R*,3S*)-1,4-dimercapto-2,3-butanediol; (2R*,3S*)-1,4-dimercaptobutane-2,3-diol; (R*,R*)-1,4-DIMERCAPTO-2,3-BUTANEDIOL; 1,4-Bissulfanylbutane-2,3-diol; 1,4-Disulfanylbutane-2,3-diol; 16096-97-2; 2,3-Butanediol, 1,4-dimercapto-, (R*,R*)-; 2,3-Butanediol, 1,4-dimercapto-, (R*,S*)-; (2R,3R)-1,4-disulfanylbutane-2,3-diol |
분자식 |
C4H10O2S2 |
분자량 |
154.251 |
InChI |
InChI=1/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4-/m0/s1 |
cas번호 |
16096-97-2 |
EC번호 |
240-263-0 |
분자 구조 |
|
밀도 |
1.302g/cm3 |
녹는 점 |
50-54℃ |
비등점 |
364.5°C at 760 mmHg |
굴절 지수 |
1.579 |
인화점 |
174.2°C |
증기압 |
8.68E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|