ChemNet > CAS > 161446-90-8 3-Chloro-4-fluorobenzyl alcohol
161446-90-8 3-Chloro-4-fluorobenzyl alcohol
상품명칭 |
3-Chloro-4-fluorobenzyl alcohol |
영문 이름 |
3-Chloro-4-fluorobenzyl alcohol; (3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
분자식 |
C7H6ClFO |
분자량 |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
cas번호 |
161446-90-8 |
분자 구조 |
|
밀도 |
1.344g/cm3 |
비등점 |
242.5°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
100.4°C |
증기압 |
0.0183mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|