ChemNet > CAS > 16208-17-6 4-Methoxyphenylglyoxal hydrate
16208-17-6 4-Methoxyphenylglyoxal hydrate
상품명칭 |
4-Methoxyphenylglyoxal hydrate |
영문 이름 |
4-Methoxyphenylglyoxal hydrate; 4-methoxyphenylglyoxal hydrate, dry wt. Basis; 2,2-dihydroxy-1-(4-methoxyphenyl)ethanone |
분자식 |
C9H10O4 |
분자량 |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,9,11-12H,1H3 |
cas번호 |
16208-17-6 |
분자 구조 |
|
밀도 |
1.297g/cm3 |
비등점 |
335°C at 760 mmHg |
굴절 지수 |
1.569 |
인화점 |
136.2°C |
증기압 |
4.85E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|