ChemNet > CAS > 16308-92-2 2,4-Dimethylbenzyl alcohol
16308-92-2 2,4-Dimethylbenzyl alcohol
상품명칭 |
2,4-Dimethylbenzyl alcohol |
영문 이름 |
2,4-Dimethylbenzyl alcohol; |
분자식 |
C9H12O |
분자량 |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-3-4-9(6-10)8(2)5-7/h3-5,10H,6H2,1-2H3 |
cas번호 |
16308-92-2 |
EC번호 |
240-393-8 |
분자 구조 |
|
밀도 |
1.002g/cm3 |
비등점 |
232°C at 760 mmHg |
굴절 지수 |
1.536 |
인화점 |
101.7°C |
증기압 |
0.0337mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|