ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
상품명칭 |
Diethyl phenylphosphonite |
영문 이름 |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
분자식 |
C10H15O2P |
분자량 |
198.1987 |
InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
cas번호 |
1638-86-4 |
EC번호 |
216-676-7 |
분자 구조 |
|
비등점 |
235°C at 760 mmHg |
인화점 |
113°C |
증기압 |
0.0784mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|