ChemNet > CAS > 16382-15-3 Ethyl 5-methylindole-2-carboxylate
16382-15-3 Ethyl 5-methylindole-2-carboxylate
| 상품명칭 |
Ethyl 5-methylindole-2-carboxylate |
| 영문 이름 |
Ethyl 5-methylindole-2-carboxylate; 5-Methylindole-2-carboxylic acid ethyl ester; ethyl 5-methyl-1H-indole-2-carboxylate |
| 분자식 |
C12H13NO2 |
| 분자량 |
203.2371 |
| InChI |
InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| cas번호 |
16382-15-3 |
| 분자 구조 |
|
| 밀도 |
1.177g/cm3 |
| 비등점 |
356.5°C at 760 mmHg |
| 굴절 지수 |
1.609 |
| 인화점 |
169.4°C |
| 증기압 |
2.9E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
