ChemNet > CAS > 16493-35-9 Undecyl methacrylate
16493-35-9 Undecyl methacrylate
| 상품명칭 |
Undecyl methacrylate |
| 영문 이름 |
Undecyl methacrylate;2-Propenoic acid, 2-methyl-, undecyl ester; undecyl 2-methylprop-2-enoate |
| 분자식 |
C15H28O2 |
| 분자량 |
240.3816 |
| InChI |
InChI=1/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
| cas번호 |
16493-35-9 |
| EC번호 |
240-558-4 |
| 분자 구조 |
|
| 밀도 |
0.875g/cm3 |
| 비등점 |
305.9°C at 760 mmHg |
| 굴절 지수 |
1.443 |
| 인화점 |
124.4°C |
| 증기압 |
0.000797mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
