ChemNet > CAS > 16518-62-0 3-Bromo-N,N-dimethylaniline
16518-62-0 3-Bromo-N,N-dimethylaniline
| 상품명칭 |
3-Bromo-N,N-dimethylaniline |
| 영문 이름 |
3-Bromo-N,N-dimethylaniline; Benzenamine, 3-bromo-N,N-dimethyl-; 4-cyanophenyl benzoate; 3-bromo-N,N-dimethylbenzenamine |
| 분자식 |
C8H10BrN |
| 분자량 |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| cas번호 |
16518-62-0 |
| 분자 구조 |
|
| 밀도 |
1.393g/cm3 |
| 비등점 |
259.7°C at 760 mmHg |
| 굴절 지수 |
1.586 |
| 인화점 |
110.8°C |
| 증기압 |
0.0128mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| 보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
