ChemNet > CAS > 1664-54-6 3-Aminophenylpropanoic Acid
1664-54-6 3-Aminophenylpropanoic Acid
상품명칭 |
3-Aminophenylpropanoic Acid |
영문 이름 |
3-Aminophenylpropanoic Acid; 3-(3-Aminophenyl)propionic acid; 3-amino-3-phenylpropanoic acid; 3-(3-aminophenyl)propanoic acid |
분자식 |
C9H11NO2 |
분자량 |
165.1891 |
InChI |
InChI=1/C9H11NO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5,10H2,(H,11,12) |
cas번호 |
1664-54-6 |
EC번호 |
210-371-2 |
분자 구조 |
|
밀도 |
1.217g/cm3 |
비등점 |
356.2°C at 760 mmHg |
굴절 지수 |
1.597 |
인화점 |
169.2°C |
증기압 |
1.09E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|