ChemNet > CAS > 1667-01-2 2',4',6'-Trimethylacetophenone
1667-01-2 2',4',6'-Trimethylacetophenone
| 상품명칭 |
2',4',6'-Trimethylacetophenone |
| 영문 이름 |
2',4',6'-Trimethylacetophenone; 2-Acetylmesitylene; 2,4,6-Trimethylacetophenone; 1-(2,4,6-trimethylphenyl)ethanone |
| 분자식 |
C11H14O |
| 분자량 |
162.2283 |
| InChI |
InChI=1/C11H14O/c1-7-5-8(2)11(10(4)12)9(3)6-7/h5-6H,1-4H3 |
| cas번호 |
1667-01-2 |
| EC번호 |
216-783-9 |
| 분자 구조 |
|
| 밀도 |
0.955g/cm3 |
| 비등점 |
250.2°C at 760 mmHg |
| 굴절 지수 |
1.509 |
| 인화점 |
99°C |
| 증기압 |
0.022mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
