ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| 상품명칭 |
5-Nitrothiophene-2-carbonitrile |
| 영문 이름 |
5-Nitrothiophene-2-carbonitrile; 2-Cyano-5-nitrothiophene |
| 분자식 |
C5H2N2O2S |
| 분자량 |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| cas번호 |
16689-02-4 |
| 분자 구조 |
|
| 밀도 |
1.5g/cm3 |
| 비등점 |
273.9°C at 760 mmHg |
| 굴절 지수 |
1.611 |
| 인화점 |
119.4°C |
| 증기압 |
0.00558mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
