1670-46-8 2-Acetylcyclopentanone
상품명칭 |
2-Acetylcyclopentanone |
영문 이름 |
2-Acetylcyclopentanone;Cyclopentanone, 2-acetyl-; 4-07-00-01993 (Beilstein Handbook Reference); AI3-19254; BRN 1857601; NSC 141181; alpha-Acetylcyclopentanone; o-Acetylcyclopentanone; 2-Acetylcyclopentan-1-one; (2S)-2-acetylcyclopentanone; 1-(2-hydroxycyclopent-1-en-1-yl)ethanone |
분자식 |
C7H10O2 |
분자량 |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-5(8)6-3-2-4-7(6)9/h9H,2-4H2,1H3 |
cas번호 |
1670-46-8 |
EC번호 |
216-797-5 |
분자 구조 |
|
밀도 |
1.187g/cm3 |
비등점 |
239.2°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
97.8°C |
증기압 |
0.00713mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|