ChemNet > CAS > 16703-52-9 Ethyl NN-Dimethyloxamate
16703-52-9 Ethyl NN-Dimethyloxamate
| 상품명칭 |
Ethyl NN-Dimethyloxamate |
| 영문 이름 |
Ethyl NN-Dimethyloxamate; Ethyl N,N-dimethyloxamate; N,N-Dimethyloxamic acid ethyl ester; ethyl (dimethylamino)(oxo)acetate; Ethyl-N,N-dimethyl oxamate |
| 분자식 |
C6H11NO3 |
| 분자량 |
145.1564 |
| InChI |
InChI=1/C6H11NO3/c1-4-10-6(9)5(8)7(2)3/h4H2,1-3H3 |
| cas번호 |
16703-52-9 |
| EC번호 |
240-755-5 |
| 분자 구조 |
|
| 밀도 |
1.071g/cm3 |
| 비등점 |
176.6°C at 760 mmHg |
| 굴절 지수 |
1.435 |
| 인화점 |
60.6°C |
| 증기압 |
1.09mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
