ChemNet > CAS > 16713-66-9 3,3-Tetramethyleneglutaric acid
16713-66-9 3,3-Tetramethyleneglutaric acid
| 상품명칭 |
3,3-Tetramethyleneglutaric acid |
| 영문 이름 |
3,3-Tetramethyleneglutaric acid; Cyclopentane-1,1-diacetic acid; 1,1-cyclopentanediacetic acid; 2,2'-cyclopentane-1,1-diyldiacetic acid; 2,2'-cyclopentane-1,1-diyldiacetate |
| 분자식 |
C9H12O4 |
| 분자량 |
184.1903 |
| InChI |
InChI=1/C9H14O4/c10-7(11)5-9(6-8(12)13)3-1-2-4-9/h1-6H2,(H,10,11)(H,12,13)/p-2 |
| cas번호 |
16713-66-9 |
| EC번호 |
240-761-8 |
| 분자 구조 |
|
| 녹는 점 |
180-181℃ |
| 비등점 |
396.2°C at 760 mmHg |
| 인화점 |
207.6°C |
| 증기압 |
2.21E-07mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
