ChemNet > CAS > 16718-12-0 2-(Phenylthio)thiophene
16718-12-0 2-(Phenylthio)thiophene
| 상품명칭 |
2-(Phenylthio)thiophene |
| 영문 이름 |
2-(Phenylthio)thiophene; Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
| 분자식 |
C10H8S2 |
| 분자량 |
192.3005 |
| InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
| cas번호 |
16718-12-0 |
| 분자 구조 |
|
| 밀도 |
1.24g/cm3 |
| 비등점 |
304.7°C at 760 mmHg |
| 굴절 지수 |
1.667 |
| 인화점 |
138.1°C |
| 증기압 |
0.00155mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
