ChemNet > CAS > 167678-46-8 3-Acetoxy-2-Methylbenzoyl Chloride
167678-46-8 3-Acetoxy-2-Methylbenzoyl Chloride
상품명칭 |
3-Acetoxy-2-Methylbenzoyl Chloride |
영문 이름 |
3-Acetoxy-2-Methylbenzoyl Chloride; 3-Acetoxy-o-toluoyl chloride; 2-methyl-3-acetoxybenzoic chloride; 3-acetoxy-2-methylbenzoic chloride; 3-(chlorocarbonyl)-2-methylphenyl acetate; 2-methyl-3-acetoxy benzoic chloride |
분자식 |
C10H9ClO3 |
분자량 |
212.6297 |
InChI |
InChI=1/C10H9ClO3/c1-6-8(10(11)13)4-3-5-9(6)14-7(2)12/h3-5H,1-2H3 |
cas번호 |
167678-46-8 |
EC번호 |
433-690-0 |
분자 구조 |
|
밀도 |
1.252g/cm3 |
비등점 |
295.6°C at 760 mmHg |
굴절 지수 |
1.532 |
인화점 |
123.6°C |
증기압 |
0.00151mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R43:May cause sensitization by skin contact.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|