ChemNet > CAS > 1679-98-7 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole
1679-98-7 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole
상품명칭 |
2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
영문 이름 |
2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole; 2,5-Bis(4-diethylaminophenyl)-1,3,4-oxadiazole; 2,5-bis(diethylamino)phenyl-1,3,4-oxadiazole; 4,4'-(1,3,4-oxadiazole-2,5-diyl)bis(N,N-diethylaniline) |
분자식 |
C22H28N4O |
분자량 |
364.4839 |
InChI |
InChI=1/C22H28N4O/c1-5-25(6-2)19-13-9-17(10-14-19)21-23-24-22(27-21)18-11-15-20(16-12-18)26(7-3)8-4/h9-16H,5-8H2,1-4H3 |
cas번호 |
1679-98-7 |
EC번호 |
216-851-8 |
분자 구조 |
|
밀도 |
1.1g/cm3 |
비등점 |
526.4°C at 760 mmHg |
굴절 지수 |
1.585 |
인화점 |
272.2°C |
증기압 |
3.59E-11mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|