1696-17-9 N,N-Diethylbenzamide
상품명칭 |
N,N-Diethylbenzamide |
영문 이름 |
N,N-Diethylbenzamide;Rebemide; 4-09-00-00728 (Beilstein Handbook Reference); AI3-01197; BRN 1909505; Benzoic acid N,N-diethylamide; Benzoic acid diethylamide; Benzoyldiethylamine; NSC 16060; R 2; R 2 (VAN); R 2 (insect repellant); R 2 (insect repellent); R2; REP; Rebemid; Benzamide, N,N-diethyl- |
분자식 |
C11H15NO |
분자량 |
177.2429 |
InChI |
InChI=1/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
cas번호 |
1696-17-9 |
EC번호 |
216-912-9 |
분자 구조 |
|
밀도 |
0.997g/cm3 |
비등점 |
288.7°C at 760 mmHg |
굴절 지수 |
1.518 |
인화점 |
125.5°C |
증기압 |
0.0023mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|