ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
상품명칭 |
4-Amino-3-ethylbenzonitrile |
영문 이름 |
4-Amino-3-ethylbenzonitrile; 4-Cyano-2-ethylaniline |
분자식 |
C9H10N2 |
분자량 |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
cas번호 |
170230-87-2 |
분자 구조 |
|
밀도 |
1.07g/cm3 |
비등점 |
297.1°C at 760 mmHg |
굴절 지수 |
1.562 |
인화점 |
133.5°C |
증기압 |
0.00138mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|