170918-42-0 (R)-페닐 슈퍼콰트
상품명칭 |
(R)-페닐 슈퍼콰트 |
별명 |
;(R) -5,5- 디메틸 -4- 페닐 -2- 옥사 졸리 디논; (4R)-5,5-디메틸-4-페닐-1,3-옥사졸리딘-2-온 |
영문 이름 |
(R)-Phenyl superquat; (R)-5,5-Dimethyl-4-phenyl-2-oxazolidinone; (4R)-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
분자식 |
C11H13NO2 |
분자량 |
191.2264 |
InChI |
InChI=1/C11H13NO2/c1-11(2)9(12-10(13)14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3,(H,12,13)/t9-/m1/s1 |
cas번호 |
170918-42-0 |
분자 구조 |
|
밀도 |
1.093g/cm3 |
녹는 점 |
155-159℃ |
비등점 |
383.2°C at 760 mmHg |
굴절 지수 |
1.514 |
인화점 |
185.6°C |
증기압 |
4.47E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|