1711-10-0 3-iodobenzoyl chloride

상품명칭	3-iodobenzoyl chloride
영문 이름	3-iodobenzoyl chloride;
분자식	C₇H₄ClIO
분자량	266.46
InChI	InChI=1/C7H4ClIO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H
cas번호	1711-10-0
EC번호	216-979-4
분자 구조
위험성 표시
리스크 규칙	R34:Causes burns.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;