ChemNet > CAS > 17138-28-2 Ethyl 4-hydroxyphenylacetate
17138-28-2 Ethyl 4-hydroxyphenylacetate
상품명칭 |
Ethyl 4-hydroxyphenylacetate |
영문 이름 |
Ethyl 4-hydroxyphenylacetate; 4-Hydroxyphenylacetic acid ethyl ester |
분자식 |
C10H12O3 |
분자량 |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-2-13-10(12)7-8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 |
cas번호 |
17138-28-2 |
EC번호 |
241-197-5 |
분자 구조 |
|
밀도 |
1.146g/cm3 |
비등점 |
290.8°C at 760 mmHg |
굴절 지수 |
1.532 |
인화점 |
122.7°C |
증기압 |
0.00116mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|