ChemNet > CAS > 17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
| 상품명칭 |
ethyl 4-hydroxycyclohexanecarboxylate |
| 영문 이름 |
ethyl 4-hydroxycyclohexanecarboxylate; Ethyl 4-hydroxycyclohexanecarboxylate,mixture of cis and trans; Ethyl 4-hydroxycyclohexane carboxylate |
| 분자식 |
C9H16O3 |
| 분자량 |
172.2215 |
| InChI |
InChI=1/C9H16O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7-8,10H,2-6H2,1H3 |
| cas번호 |
17159-80-7 |
| EC번호 |
241-215-1 |
| 분자 구조 |
|
| 밀도 |
1.093g/cm3 |
| 비등점 |
251.4°C at 760 mmHg |
| 굴절 지수 |
1.481 |
| 인화점 |
100.2°C |
| 증기압 |
0.00322mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
