ChemNet > CAS > 17213-57-9 3,5-Dimethoxybenzoyl chloride
17213-57-9 3,5-Dimethoxybenzoyl chloride
상품명칭 |
3,5-Dimethoxybenzoyl chloride |
영문 이름 |
3,5-Dimethoxybenzoyl chloride; |
분자식 |
C9H9ClO3 |
분자량 |
200.619 |
InChI |
InChI=1/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
cas번호 |
17213-57-9 |
EC번호 |
241-256-5 |
분자 구조 |
|
밀도 |
1.224g/cm3 |
녹는 점 |
41-47℃ |
비등점 |
284.5°C at 760 mmHg |
굴절 지수 |
1.52 |
인화점 |
131.1°C |
증기압 |
0.00296mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|