17249-79-5;17249-29-5 2,3-Dichlorothiophene
상품명칭 |
2,3-Dichlorothiophene |
영문 이름 |
2,3-Dichlorothiophene; 2,3-dichloro-thiophene |
분자식 |
C4H2Cl2S |
분자량 |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
cas번호 |
17249-79-5;17249-29-5 |
분자 구조 |
|
밀도 |
1.488g/cm3 |
녹는 점 |
-26℃ |
비등점 |
170.7°C at 760 mmHg |
굴절 지수 |
1.584 |
인화점 |
68.9°C |
증기압 |
1.93mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|