815-82-7;17263-56-8 Cupric Tartrate
| 상품명칭 |
Cupric Tartrate |
| 영문 이름 |
Cupric Tartrate; Copper(II) tartrate hydrate; Coppertartratehydratebluegreenxtl; Tartaric acid cupric salt; copper(2+) (2R,3R)-2,3-dihydroxybutanedioate |
| 분자식 |
C4H4CuO6 |
| 분자량 |
211.617 |
| InChI |
InChI=1/C4H6O6.Cu/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2/t1-,2-;/m1./s1 |
| cas번호 |
815-82-7;17263-56-8 |
| EC번호 |
212-425-0 |
| 분자 구조 |
|
| 비등점 |
399.3°C at 760 mmHg |
| 인화점 |
209.4°C |
| 물 용해도 |
slightly soluble |
| 증기압 |
4.93E-08mmHg at 25°C |
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|