ChemNet > CAS > 17277-58-6 Methyl (phenylthio)acetate
17277-58-6 Methyl (phenylthio)acetate
| 상품명칭 |
Methyl (phenylthio)acetate |
| 영문 이름 |
Methyl (phenylthio)acetate; Methyl (phenylmercapto)acetate~(Phenylthio)acetic acid methyl ester; methyl (phenylsulfanyl)acetate |
| 분자식 |
C9H10O2S |
| 분자량 |
182.2395 |
| InChI |
InChI=1/C9H10O2S/c1-11-9(10)7-12-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| cas번호 |
17277-58-6 |
| 분자 구조 |
|
| 밀도 |
1.16g/cm3 |
| 비등점 |
259.3°C at 760 mmHg |
| 굴절 지수 |
1.556 |
| 인화점 |
115.3°C |
| 증기압 |
0.013mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
