ChemNet > CAS > 17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
상품명칭 |
(2R,5R)-(-)-2,5-Hexanediol |
영문 이름 |
(2R,5R)-(-)-2,5-Hexanediol; (2R,5R)-2,5-Hexanediol; Hexanediolcolorlessxtl; (2R,5R)-Dihydroxyhexane; (2R,5R)-hexane-2,5-diol |
분자식 |
C6H14O2 |
분자량 |
118.1742 |
InChI |
InChI=1/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
cas번호 |
17299-07-9 |
분자 구조 |
|
밀도 |
0.958g/cm3 |
녹는 점 |
50-53℃ |
비등점 |
213.4°C at 760 mmHg |
굴절 지수 |
1.445 |
인화점 |
101.7°C |
증기압 |
0.0364mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|