ChemNet > CAS > 17302-82-8 Ethyl 3,5-dichloro-4-hydroxybenzoate
17302-82-8 Ethyl 3,5-dichloro-4-hydroxybenzoate
| 상품명칭 |
Ethyl 3,5-dichloro-4-hydroxybenzoate |
| 영문 이름 |
Ethyl 3,5-dichloro-4-hydroxybenzoate; 3,5-Dichloro-4-hydroxybenzoic acid ethyl ester |
| 분자식 |
C9H8Cl2O3 |
| 분자량 |
235.064 |
| InChI |
InChI=1/C9H8Cl2O3/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,12H,2H2,1H3 |
| cas번호 |
17302-82-8 |
| EC번호 |
241-331-2 |
| 분자 구조 |
|
| 밀도 |
1.414g/cm3 |
| 녹는 점 |
98-102℃ |
| 비등점 |
316.6°C at 760 mmHg |
| 굴절 지수 |
1.567 |
| 인화점 |
145.3°C |
| 증기압 |
0.000219mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
