1732-08-7 Dimethyl pimelate
상품명칭 |
Dimethyl pimelate |
영문 이름 |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
분자식 |
C9H16O4 |
분자량 |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
cas번호 |
1732-08-7 |
EC번호 |
217-057-4 |
분자 구조 |
|
밀도 |
1.022g/cm3 |
비등점 |
250.3°C at 760 mmHg |
굴절 지수 |
1.427 |
인화점 |
105.4°C |
증기압 |
0.0219mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|