173550-97-5 Terephthalic acid mono(2-bromoethyl) ester

상품명칭	Terephthalic acid mono(2-bromoethyl) ester
영문 이름	Terephthalic acid mono(2-bromoethyl) ester; 2-Bromoethyl hydrogen terephthalate; 4-[(2-bromoethoxy)carbonyl]benzoic acid
분자식	C₁₀H₉BrO₄
분자량	273.0801
InChI	InChI=1/C10H9BrO4/c11-5-6-15-10(14)8-3-1-7(2-4-8)9(12)13/h1-4H,5-6H2,(H,12,13)
cas번호	173550-97-5
분자 구조
밀도	1.61g/cm³
비등점	412.8°C at 760 mmHg
굴절 지수	1.591
인화점	203.5°C
증기압	1.48E-07mmHg at 25°C
위험성 표시
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;