17356-19-3 1-Ethynylcyclopentanol
상품명칭 |
1-Ethynylcyclopentanol |
영문 이름 |
1-Ethynylcyclopentanol; |
분자식 |
C7H10O |
분자량 |
110.1537 |
InChI |
InChI=1/C7H10O/c1-2-7(8)5-3-4-6-7/h1,8H,3-6H2 |
cas번호 |
17356-19-3 |
EC번호 |
241-385-7 |
분자 구조 |
|
밀도 |
1.01g/cm3 |
녹는 점 |
27-159℃ |
비등점 |
155.4°C at 760 mmHg |
굴절 지수 |
1.497 |
인화점 |
48.9°C |
증기압 |
1.1mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37:Irritating to eyes and respiratory system.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|