ChemNet > CAS > 17467-15-1 5-Amino-3-phenyl-1,2,4-thiadiazole
17467-15-1 5-Amino-3-phenyl-1,2,4-thiadiazole
상품명칭 |
5-Amino-3-phenyl-1,2,4-thiadiazole |
영문 이름 |
5-Amino-3-phenyl-1,2,4-thiadiazole; 3-phenyl-1,2,4-thiadiazol-5-ylamine; 3-methylhex-2-ene; 3-phenyl-1,2,4-thiadiazol-5-amine |
분자식 |
C8H7N3S |
분자량 |
177.2263 |
InChI |
InChI=1/C8H7N3S/c9-8-10-7(11-12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11) |
cas번호 |
17467-15-1 |
EC번호 |
241-485-0 |
분자 구조 |
|
밀도 |
1.333g/cm3 |
녹는 점 |
152-156℃ |
비등점 |
359°C at 760 mmHg |
굴절 지수 |
1.669 |
인화점 |
170.9°C |
증기압 |
2.45E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|