ChemNet > CAS > 175135-73-6 2,5-difluorophenylhydrazine hydrochloride
175135-73-6 2,5-difluorophenylhydrazine hydrochloride
상품명칭 |
2,5-difluorophenylhydrazine hydrochloride |
영문 이름 |
2,5-difluorophenylhydrazine hydrochloride;1,1,1,3-tetrachloro-2,2,3,3-tetrafluoropropane; (2,5-difluorophenyl)diazanium chloride |
분자식 |
C6H7ClF2N2 |
분자량 |
180.583 |
InChI |
InChI=1/C6H6F2N2.ClH/c7-4-1-2-5(8)6(3-4)10-9;/h1-3,10H,9H2;1H |
cas번호 |
175135-73-6 |
EC번호 |
218-868-6 |
분자 구조 |
|
녹는 점 |
210℃ |
비등점 |
189.5°C at 760 mmHg |
인화점 |
68.4°C |
증기압 |
0.567mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|