ChemNet > CAS > 175203-47-1 3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile
175203-47-1 3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile
상품명칭 |
3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
영문 이름 |
3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile;3-benzyl-1-(1-methylethyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
분자식 |
C15H15N3O2 |
분자량 |
269.2985 |
InChI |
InChI=1/C15H15N3O2/c1-11(2)17-10-13(8-16)14(19)18(15(17)20)9-12-6-4-3-5-7-12/h3-7,10-11H,9H2,1-2H3 |
cas번호 |
175203-47-1 |
분자 구조 |
|
밀도 |
1.26g/cm3 |
녹는 점 |
151℃ |
비등점 |
399.1°C at 760 mmHg |
굴절 지수 |
1.609 |
인화점 |
195.1°C |
증기압 |
1.41E-06mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|