ChemNet > CAS > 175204-69-0 4-히드라지노-6-(2-피리딜)-1,3,5-트리아진-2-아민
175204-69-0 4-히드라지노-6-(2-피리딜)-1,3,5-트리아진-2-아민
| 상품명칭 |
4-히드라지노-6-(2-피리딜)-1,3,5-트리아진-2-아민 |
| 별명 |
4-히드라지닐-6-(피리딘-2-일)-1,3,5-트리아진-2-아민 |
| 영문 이름 |
4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine;4-hydrazinyl-6-(pyridin-2-yl)-1,3,5-triazin-2-amine |
| 분자식 |
C8H9N7 |
| 분자량 |
203.204 |
| InChI |
InChI=1/C8H9N7/c9-7-12-6(13-8(14-7)15-10)5-3-1-2-4-11-5/h1-4H,10H2,(H3,9,12,13,14,15) |
| cas번호 |
175204-69-0 |
| 분자 구조 |
|
| 밀도 |
1.488g/cm3 |
| 녹는 점 |
287℃ |
| 비등점 |
550.8°C at 760 mmHg |
| 굴절 지수 |
1.756 |
| 인화점 |
286.9°C |
| 증기압 |
3.52E-12mmHg at 25°C |
| 위험성 표시 |
Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|