17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one

상품명칭	3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
영문 이름	3-Chloro-5,5-dimethyl-2-cyclohexen-1-one;3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one
분자식	C₈H₁₁ClO
분자량	158.6253
InChI	InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3
cas번호	17530-69-7
분자 구조
밀도	1.09g/cm³
비등점	217.7°C at 760 mmHg
굴절 지수	1.488
인화점	104.8°C
증기압	0.131mmHg at 25°C
위험성 표시
리스크 규칙	R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;