ChemNet > CAS > 1754-55-8 Ethyl 2,4,6-trimethylbenzoate
1754-55-8 Ethyl 2,4,6-trimethylbenzoate
상품명칭 |
Ethyl 2,4,6-trimethylbenzoate |
영문 이름 |
Ethyl 2,4,6-trimethylbenzoate; Ethyl mesitoate~2,4,6-Trimethylbenzoic acid ethyl ester |
분자식 |
C12H16O2 |
분자량 |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-5-14-12(13)11-9(3)6-8(2)7-10(11)4/h6-7H,5H2,1-4H3 |
cas번호 |
1754-55-8 |
EC번호 |
217-143-1 |
분자 구조 |
|
밀도 |
0.997g/cm3 |
비등점 |
257.8°C at 760 mmHg |
굴절 지수 |
1.504 |
인화점 |
113.8°C |
증기압 |
0.0143mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|