ChemNet > CAS > 175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
| 상품명칭 |
(4-Methoxy-3-methylphenyl)boronic acid |
| 영문 이름 |
(4-Methoxy-3-methylphenyl)boronic acid; 4-Methoxy-3-methylphenylboronic acid; 4-Methoxy-3-methylbenzeneboronic acid |
| 분자식 |
C8H11BO3 |
| 분자량 |
165.9821 |
| InChI |
InChI=1/C8H11BO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5,10-11H,1-2H3 |
| cas번호 |
175883-62-2 |
| 분자 구조 |
|
| 밀도 |
1.14g/cm3 |
| 비등점 |
321.4°C at 760 mmHg |
| 굴절 지수 |
1.52 |
| 인화점 |
148.2°C |
| 증기압 |
0.000124mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|