17598-02-6 Precocene I
상품명칭 |
Precocene I |
영문 이름 |
Precocene I; 7-Methoxy-2,2-dimethylchromene; 7-methoxy-2,2-dimethyl-2H-chromene |
분자식 |
C12H14O2 |
분자량 |
190.2384 |
InChI |
InChI=1/C12H14O2/c1-12(2)7-6-9-4-5-10(13-3)8-11(9)14-12/h4-8H,1-3H3 |
cas번호 |
17598-02-6 |
EC번호 |
241-566-0 |
분자 구조 |
|
밀도 |
1.039g/cm3 |
비등점 |
292.7°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
105.1°C |
증기압 |
0.00315mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|