ChemNet > CAS > 17608-10-5 2-(4-Chlorophenyl)ethyl isothiocyanate
17608-10-5 2-(4-Chlorophenyl)ethyl isothiocyanate
| 상품명칭 |
2-(4-Chlorophenyl)ethyl isothiocyanate |
| 영문 이름 |
2-(4-Chlorophenyl)ethyl isothiocyanate; 2-(4-Chlorophenethyl) isothiocyanate; 1-chloro-4-(2-isothiocyanatoethyl)benzene |
| 분자식 |
C9H8ClNS |
| 분자량 |
197.6845 |
| InChI |
InChI=1/C9H8ClNS/c10-9-3-1-8(2-4-9)5-6-11-7-12/h1-4H,5-6H2 |
| cas번호 |
17608-10-5 |
| 분자 구조 |
|
| 밀도 |
1.15g/cm3 |
| 비등점 |
311°C at 760 mmHg |
| 굴절 지수 |
1.572 |
| 인화점 |
141.9°C |
| 증기압 |
0.00106mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
